Carboxylic acids and derivatives
Filtered Search Results
2-Ketoglutaric acid, disodium salt, dihydrate, 99%
CAS: 305-72-6 Molecular Formula: C5H4Na2O5·2H2O Molecular Weight (g/mol): 226.1 MDL Number: MFCD00150702 InChI Key: YBGBJYVHJTVUSL-UHFFFAOYSA-L Synonym: disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate PubChem CID: 31040 IUPAC Name: disodium;2-oxopentanedioate SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 31040 |
|---|---|
| CAS | 305-72-6 |
| Molecular Weight (g/mol) | 226.1 |
| MDL Number | MFCD00150702 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate |
| IUPAC Name | disodium;2-oxopentanedioate |
| InChI Key | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| Molecular Formula | C5H4Na2O5·2H2O |
Methyl p-toluate, 99%
CAS: 99-75-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00008441 InChI Key: QSSJZLPUHJDYKF-UHFFFAOYSA-N Synonym: methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate PubChem CID: 7455 IUPAC Name: methyl 4-methylbenzoate SMILES: CC1=CC=C(C=C1)C(=O)OC
| PubChem CID | 7455 |
|---|---|
| CAS | 99-75-2 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00008441 |
| SMILES | CC1=CC=C(C=C1)C(=O)OC |
| Synonym | methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate |
| IUPAC Name | methyl 4-methylbenzoate |
| InChI Key | QSSJZLPUHJDYKF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Methyl oxalyl chloride, 97%
CAS: 5781-53-3 Molecular Formula: C3H3ClO3 Molecular Weight (g/mol): 122.504 MDL Number: MFCD00000705 InChI Key: ZXUQEPZWVQIOJE-UHFFFAOYSA-N Synonym: methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate PubChem CID: 79846 IUPAC Name: methyl 2-chloro-2-oxoacetate SMILES: COC(=O)C(=O)Cl
| PubChem CID | 79846 |
|---|---|
| CAS | 5781-53-3 |
| Molecular Weight (g/mol) | 122.504 |
| MDL Number | MFCD00000705 |
| SMILES | COC(=O)C(=O)Cl |
| Synonym | methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate |
| IUPAC Name | methyl 2-chloro-2-oxoacetate |
| InChI Key | ZXUQEPZWVQIOJE-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClO3 |
Methyl 2-fluoroacrylate, 95%, stab. with 1% BHT
CAS: 2343-89-7 Molecular Formula: C4H5FO2 Molecular Weight (g/mol): 104.08 MDL Number: MFCD04039286 InChI Key: ZTZJVAOTIOAZGZ-UHFFFAOYSA-N Synonym: methyl 2-fluoroacrylate,methyl-2-fluoroacrylate,2-fluoroacrylic acid methyl ester,methyl fluoroacrylate,2-propenoic acid, 2-fluoro-, methyl ester,methyl a-fluoroacrylate,pubchem12658,methyl alpha-fluoroacrylate,acmc-209g3b,ksc493a9d PubChem CID: 2782524 IUPAC Name: methyl 2-fluoroprop-2-enoate SMILES: COC(=O)C(=C)F
| PubChem CID | 2782524 |
|---|---|
| CAS | 2343-89-7 |
| Molecular Weight (g/mol) | 104.08 |
| MDL Number | MFCD04039286 |
| SMILES | COC(=O)C(=C)F |
| Synonym | methyl 2-fluoroacrylate,methyl-2-fluoroacrylate,2-fluoroacrylic acid methyl ester,methyl fluoroacrylate,2-propenoic acid, 2-fluoro-, methyl ester,methyl a-fluoroacrylate,pubchem12658,methyl alpha-fluoroacrylate,acmc-209g3b,ksc493a9d |
| IUPAC Name | methyl 2-fluoroprop-2-enoate |
| InChI Key | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N |
| Molecular Formula | C4H5FO2 |
DL - Lactic Acid Lithium Salt, MP Biomedicals™
CAS: 867-55-0 Molecular Formula: C3H5LiO3 Molecular Weight (g/mol): 96.01 InChI Key: GKQWYZBANWAFMQ-UHFFFAOYNA-M IUPAC Name: lithium(1+) 2-hydroxypropanoate SMILES: [Li+].CC(O)C([O-])=O
| CAS | 867-55-0 |
|---|---|
| Molecular Weight (g/mol) | 96.01 |
| SMILES | [Li+].CC(O)C([O-])=O |
| IUPAC Name | lithium(1+) 2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-UHFFFAOYNA-M |
| Molecular Formula | C3H5LiO3 |
N-Methylphthalimide, 98%, Thermo Scientific Chemicals
CAS: 550-44-7 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD00023063 InChI Key: ZXLYYQUMYFHCLQ-UHFFFAOYSA-N Synonym: n-methylphthalimide,2-methylisoindoline-1,3-dione,phthalimide, n-methyl,1h-isoindole-1,3 2h-dione, 2-methyl,unii-647up45j2u,2-methyl-1h-isoindole-1,3 2h-dione,n-methyl phthalimide,dsstox_cid_7198,acmc-1b11u PubChem CID: 11074 IUPAC Name: 2-methylisoindole-1,3-dione SMILES: CN1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 11074 |
|---|---|
| CAS | 550-44-7 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00023063 |
| SMILES | CN1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-methylphthalimide,2-methylisoindoline-1,3-dione,phthalimide, n-methyl,1h-isoindole-1,3 2h-dione, 2-methyl,unii-647up45j2u,2-methyl-1h-isoindole-1,3 2h-dione,n-methyl phthalimide,dsstox_cid_7198,acmc-1b11u |
| IUPAC Name | 2-methylisoindole-1,3-dione |
| InChI Key | ZXLYYQUMYFHCLQ-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
Sodium Propionate, FCC, 99-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.06 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M IUPAC Name: sodium propanoate SMILES: [Na+].CCC([O-])=O
| CAS | 137-40-6 |
|---|---|
| Molecular Weight (g/mol) | 96.06 |
| SMILES | [Na+].CCC([O-])=O |
| IUPAC Name | sodium propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
Methyl 2-butynoate, 97%
CAS: 23326-27-4 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.1 MDL Number: MFCD00009273 InChI Key: UJQCANQILFWSDJ-UHFFFAOYSA-N Synonym: methyl 2-butynoate,methyl tetrolate,2-butynoic acid, methyl ester,2-butynoic acid methyl ester,tetrolic acid methyl ester,but-2-ynoic acid methyl ester,methyl2-butynoate,methyl 2-butynoate ?,pubchem12783,acmc-1ceil PubChem CID: 141019 IUPAC Name: methyl but-2-ynoate SMILES: CC#CC(=O)OC
| PubChem CID | 141019 |
|---|---|
| CAS | 23326-27-4 |
| Molecular Weight (g/mol) | 98.1 |
| MDL Number | MFCD00009273 |
| SMILES | CC#CC(=O)OC |
| Synonym | methyl 2-butynoate,methyl tetrolate,2-butynoic acid, methyl ester,2-butynoic acid methyl ester,tetrolic acid methyl ester,but-2-ynoic acid methyl ester,methyl2-butynoate,methyl 2-butynoate ?,pubchem12783,acmc-1ceil |
| IUPAC Name | methyl but-2-ynoate |
| InChI Key | UJQCANQILFWSDJ-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Copper(II) formate tetrahydrate, 98%
CAS: 5893-61-8 Molecular Formula: C2H10CuO8 Molecular Weight (g/mol): 225.64 MDL Number: MFCD00167128 InChI Key: LSIWWRSSSOYIMS-UHFFFAOYSA-L Synonym: copper ii formate tetrahydrate,cupric formate tetrahydrate,copper diformate tetrahydrate,unii-v7ra28204j,copper 2+ formate tetrahydrate,cupric formate tetrahydrate mi,copper formate cu hcoo 2 tetrahydrate,formic acid copper salt 2:1 tetrahydrate,acmc-209m8c PubChem CID: 6432244 IUPAC Name: copper;diformate;tetrahydrate SMILES: C(=O)[O-].C(=O)[O-].O.O.O.O.[Cu+2]
| PubChem CID | 6432244 |
|---|---|
| CAS | 5893-61-8 |
| Molecular Weight (g/mol) | 225.64 |
| MDL Number | MFCD00167128 |
| SMILES | C(=O)[O-].C(=O)[O-].O.O.O.O.[Cu+2] |
| Synonym | copper ii formate tetrahydrate,cupric formate tetrahydrate,copper diformate tetrahydrate,unii-v7ra28204j,copper 2+ formate tetrahydrate,cupric formate tetrahydrate mi,copper formate cu hcoo 2 tetrahydrate,formic acid copper salt 2:1 tetrahydrate,acmc-209m8c |
| IUPAC Name | copper;diformate;tetrahydrate |
| InChI Key | LSIWWRSSSOYIMS-UHFFFAOYSA-L |
| Molecular Formula | C2H10CuO8 |
N-(Chloromethyl)phthalimide, 97%
CAS: 17564-64-6 Molecular Formula: C9H6ClNO2 Molecular Weight (g/mol): 195.602 MDL Number: MFCD00005898 InChI Key: JKGLRGGCGUQNEX-UHFFFAOYSA-N Synonym: n-chloromethyl phthalimide,2-chloromethyl isoindoline-1,3-dione,n-chloromethylphthalimide,chloromethylphthalimide,n-chloromethyltrimellitimide,1h-isoindole-1,3 2h-dione, 2-chloromethyl,phthalimide, n-chloromethyl,2-chloromethyl isoindole-1,3-dione,2-chloromethyl-1h-isoindole-1,3 2h-dione PubChem CID: 87154 IUPAC Name: 2-(chloromethyl)isoindole-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CCl
| PubChem CID | 87154 |
|---|---|
| CAS | 17564-64-6 |
| Molecular Weight (g/mol) | 195.602 |
| MDL Number | MFCD00005898 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCl |
| Synonym | n-chloromethyl phthalimide,2-chloromethyl isoindoline-1,3-dione,n-chloromethylphthalimide,chloromethylphthalimide,n-chloromethyltrimellitimide,1h-isoindole-1,3 2h-dione, 2-chloromethyl,phthalimide, n-chloromethyl,2-chloromethyl isoindole-1,3-dione,2-chloromethyl-1h-isoindole-1,3 2h-dione |
| IUPAC Name | 2-(chloromethyl)isoindole-1,3-dione |
| InChI Key | JKGLRGGCGUQNEX-UHFFFAOYSA-N |
| Molecular Formula | C9H6ClNO2 |
Methyl trans-2-hexenoate, 97%
CAS: 13894-63-8 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00048798 InChI Key: GFUGBRNILVVWIE-AATRIKPKSA-N Synonym: methyl 2-hexenoate,methyl e-2-hexenoate,methyl trans-2-hexenoate,methyl e-hex-2-enoate,methyl 2e-hexenoate,methyl 2e-hex-2-enoate,2-hexenoic acid, methyl ester, e,methyl 2e-2-hexenoate,2e-2-hexenoic acid methyl ester,unii-x2ddu82182 PubChem CID: 5364409 IUPAC Name: methyl (E)-hex-2-enoate SMILES: CCCC=CC(=O)OC
| PubChem CID | 5364409 |
|---|---|
| CAS | 13894-63-8 |
| Molecular Weight (g/mol) | 128.171 |
| MDL Number | MFCD00048798 |
| SMILES | CCCC=CC(=O)OC |
| Synonym | methyl 2-hexenoate,methyl e-2-hexenoate,methyl trans-2-hexenoate,methyl e-hex-2-enoate,methyl 2e-hexenoate,methyl 2e-hex-2-enoate,2-hexenoic acid, methyl ester, e,methyl 2e-2-hexenoate,2e-2-hexenoic acid methyl ester,unii-x2ddu82182 |
| IUPAC Name | methyl (E)-hex-2-enoate |
| InChI Key | GFUGBRNILVVWIE-AATRIKPKSA-N |
| Molecular Formula | C7H12O2 |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, 96%, stab.
CAS: 36405-47-7 Molecular Formula: C8H8F6O2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD00042311 InChI Key: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC Name: 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| PubChem CID | 549772 |
|---|---|
| CAS | 36405-47-7 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD00042311 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
| InChI Key | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molecular Formula | C8H8F6O2 |
Methyl Acetate, 96%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-20-9
| CAS | 79-20-9 |
|---|
Ethyl tiglate, 98%
CAS: 5837-78-5 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00015183 InChI Key: OAPHLAAOJMTMLY-GQCTYLIASA-N Synonym: ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate PubChem CID: 5281163 ChEBI: CHEBI:4892 IUPAC Name: ethyl (E)-2-methylbut-2-enoate SMILES: CCOC(=O)C(=CC)C
| PubChem CID | 5281163 |
|---|---|
| CAS | 5837-78-5 |
| Molecular Weight (g/mol) | 128.171 |
| ChEBI | CHEBI:4892 |
| MDL Number | MFCD00015183 |
| SMILES | CCOC(=O)C(=CC)C |
| Synonym | ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate |
| IUPAC Name | ethyl (E)-2-methylbut-2-enoate |
| InChI Key | OAPHLAAOJMTMLY-GQCTYLIASA-N |
| Molecular Formula | C7H12O2 |
Cyclohexyl methacrylate, 97%, stab. with ca 50ppm 4-methoxyphenol, Thermo Scientific Chemicals
CAS: 101-43-9 Molecular Formula: C10H16O2 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00014292 InChI Key: OIWOHHBRDFKZNC-UHFFFAOYSA-N Synonym: cyclohexyl methacrylate,methacrylic acid, cyclohexyl ester,2-propenoic acid, 2-methyl-, cyclohexyl ester,unii-5l9uuv9t6q,2-methyl-2-propenoic acid cyclohexyl ester,5l9uuv9t6q,methacrylic acid cyclohexyl ester,ageflex chma,c-hma,cyclo hexyl methacrylate PubChem CID: 7561 IUPAC Name: cyclohexyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC1CCCCC1
| PubChem CID | 7561 |
|---|---|
| CAS | 101-43-9 |
| Molecular Weight (g/mol) | 168.24 |
| MDL Number | MFCD00014292 |
| SMILES | CC(=C)C(=O)OC1CCCCC1 |
| Synonym | cyclohexyl methacrylate,methacrylic acid, cyclohexyl ester,2-propenoic acid, 2-methyl-, cyclohexyl ester,unii-5l9uuv9t6q,2-methyl-2-propenoic acid cyclohexyl ester,5l9uuv9t6q,methacrylic acid cyclohexyl ester,ageflex chma,c-hma,cyclo hexyl methacrylate |
| IUPAC Name | cyclohexyl 2-methylprop-2-enoate |
| InChI Key | OIWOHHBRDFKZNC-UHFFFAOYSA-N |
| Molecular Formula | C10H16O2 |